C12H23NO3Si — CID 10706307
(4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one (PubChem CID 10706307) has the molecular formula C12H23NO3Si and a molecular weight of 257.41 g/mol. Its IUPAC name is (4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10706307 |
| Molecular Formula | C12H23NO3Si |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1OC(=O)N[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3Si/c1-7-10-9(13-11(14)16-10)8-15-17(5,6)12(2,3)4/h7,9-10H,1,8H2,2-6H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | IGHCWNJDYJQWIR-VHSXEESVSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|