C9H16N4O — CID 107063185
3,3-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-one (PubChem CID 107063185) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-one.
| Compound Name | 3,3-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-one |
|---|---|
| PubChem CID | 107063185 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3,3-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-one |
| SMILES | CCC(C)(C)C(=O)Cc1nnn(C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-5-9(2,3)7(14)6-8-10-12-13(4)11-8/h5-6H2,1-4H3 |
| InChIKey | HEJWNMBNNIRXLU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |