C11H20N4O — CID 107063279
4,5,5-trimethyl-1-(2-methyltetrazol-5-yl)hexan-2-one (PubChem CID 107063279) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4,5,5-trimethyl-1-(2-methyltetrazol-5-yl)hexan-2-one.
| Compound Name | 4,5,5-trimethyl-1-(2-methyltetrazol-5-yl)hexan-2-one |
|---|---|
| PubChem CID | 107063279 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4,5,5-trimethyl-1-(2-methyltetrazol-5-yl)hexan-2-one |
| SMILES | CC(CC(=O)Cc1nnn(C)n1)C(C)(C)C |
| InChI | InChI=1S/C11H20N4O/c1-8(11(2,3)4)6-9(16)7-10-12-14-15(5)13-10/h8H,6-7H2,1-5H3 |
| InChIKey | WBKHISFAWZEZIO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |