C14H23F3N4 — CID 107063738
N-ethyl-2-(1-methyltriazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]ethanamine (PubChem CID 107063738) has the molecular formula C14H23F3N4 and a molecular weight of 304.36 g/mol. Its IUPAC name is N-ethyl-2-(1-methyltriazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]ethanamine.
| Compound Name | N-ethyl-2-(1-methyltriazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]ethanamine |
|---|---|
| PubChem CID | 107063738 |
| Molecular Formula | C14H23F3N4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-ethyl-2-(1-methyltriazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]ethanamine |
| SMILES | CCNC(Cc1cn(C)nn1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H23F3N4/c1-3-18-13(8-12-9-21(2)20-19-12)10-5-4-6-11(7-10)14(15,16)17/h9-11,13,18H,3-8H2,1-2H3 |
| InChIKey | YOPKQKNRYZYBAG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |