C10H16N6S — CID 107063909
N-ethyl-1-(4-methylthiadiazol-5-yl)-2-(1-methyltriazol-4-yl)ethanamine (PubChem CID 107063909) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is N-ethyl-1-(4-methylthiadiazol-5-yl)-2-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | N-ethyl-1-(4-methylthiadiazol-5-yl)-2-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107063909 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-ethyl-1-(4-methylthiadiazol-5-yl)-2-(1-methyltriazol-4-yl)ethanamine |
| SMILES | CCNC(Cc1cn(C)nn1)c1snnc1C |
| InChI | InChI=1S/C10H16N6S/c1-4-11-9(10-7(2)12-15-17-10)5-8-6-16(3)14-13-8/h6,9,11H,4-5H2,1-3H3 |
| InChIKey | IYFJFRWVVKIYMC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |