C17H26N4 — CID 107064323
4-(4-methylphenyl)-1-(1-methyltriazol-4-yl)-N-propylbutan-2-amine (PubChem CID 107064323) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1-(1-methyltriazol-4-yl)-N-propylbutan-2-amine.
| Compound Name | 4-(4-methylphenyl)-1-(1-methyltriazol-4-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 107064323 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 4-(4-methylphenyl)-1-(1-methyltriazol-4-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCc1ccc(C)cc1)Cc1cn(C)nn1 |
| InChI | InChI=1S/C17H26N4/c1-4-11-18-16(12-17-13-21(3)20-19-17)10-9-15-7-5-14(2)6-8-15/h5-8,13,16,18H,4,9-12H2,1-3H3 |
| InChIKey | DXZGOXQIXXXMQG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |