C11H16O5S — CID 10706463
prop-2-enyl (2S,4R)-2-ethoxy-6-methyl-4-oxo-2,3-dihydro-1,4-oxathiine-5-carboxylate (PubChem CID 10706463) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-2-ethoxy-6-methyl-4-oxo-2,3-dihydro-1,4-oxathiine-5-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-2-ethoxy-6-methyl-4-oxo-2,3-dihydro-1,4-oxathiine-5-carboxylate |
|---|---|
| PubChem CID | 10706463 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | prop-2-enyl (2S,4R)-2-ethoxy-6-methyl-4-oxo-2,3-dihydro-1,4-oxathiine-5-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)O[C@H](OCC)C[S@]1=O |
| InChI | InChI=1S/C11H16O5S/c1-4-6-15-11(12)10-8(3)16-9(14-5-2)7-17(10)13/h4,9H,1,5-7H2,2-3H3/t9-,17+/m0/s1 |
| InChIKey | MQLXGNDVMQNGMA-HUTHGQBESA-N |
| XLogP | 1.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|