About (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione
(8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione (PubChem CID 10706468) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione.
Molecular Properties
| Compound Name | (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione |
| PubChem CID | 10706468 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione |
| SMILES | COC1=C[C@]2(C)CC(=O)C(C(C)C)=CC2=C(C)C1=O |
| InChI | InChI=1S/C16H20O3/c1-9(2)11-6-12-10(3)15(18)14(19-5)8-16(12,4)7-13(11)17/h6,8-9H,7H2,1-5H3/t16-/m0/s1 |
| InChIKey | DRMIXJGFDXRPMS-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione?
The IUPAC name of (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione (CID 10706468) is (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione.
What is the SMILES notation for (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione?
The canonical SMILES for (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione is COC1=C[C@]2(C)CC(=O)C(C(C)C)=CC2=C(C)C1=O.
What is the InChIKey of (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione?
The InChIKey is DRMIXJGFDXRPMS-INIZCTEOSA-N. The full InChI is InChI=1S/C16H20O3/c1-9(2)11-6-12-10(3)15(18)14(19-5)8-16(12,4)7-13(11)17/h6,8-9H,7H2,1-5H3/t16-/m0/s1.
What are the key properties of (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione?
(8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione has a molecular weight of 260.33 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8aS)-7-methoxy-5,8a-dimethyl-3-propan-2-yl-1H-naphthalene-2,6-dione is sourced from PubChem (CID 10706468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).