About N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine
N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine (PubChem CID 107065155) has the molecular formula C7H13F2N5
and a molecular weight of 205.21 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine |
| PubChem CID | 107065155 |
| Molecular Formula | C7H13F2N5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine |
| SMILES | CCNC(Cc1nnn(C)n1)C(F)F |
| InChI | InChI=1S/C7H13F2N5/c1-3-10-5(7(8)9)4-6-11-13-14(2)12-6/h5,7,10H,3-4H2,1-2H3 |
| InChIKey | FSEHZJXRRDVIDQ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine?
The IUPAC name of N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine (CID 107065155) is N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine.
What is the SMILES notation for N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine?
The canonical SMILES for N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine is CCNC(Cc1nnn(C)n1)C(F)F.
What is the InChIKey of N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine?
The InChIKey is FSEHZJXRRDVIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N5/c1-3-10-5(7(8)9)4-6-11-13-14(2)12-6/h5,7,10H,3-4H2,1-2H3.
What are the key properties of N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine?
N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine has a molecular weight of 205.21 g/mol, XLogP of -0.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-amine is sourced from PubChem (CID 107065155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).