C14H17N5S — CID 107065274
1-(1-benzothiophen-3-yl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107065274) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107065274 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | CCNC(Cc1nnn(C)n1)c1csc2ccccc12 |
| InChI | InChI=1S/C14H17N5S/c1-3-15-12(8-14-16-18-19(2)17-14)11-9-20-13-7-5-4-6-10(11)13/h4-7,9,12,15H,3,8H2,1-2H3 |
| InChIKey | HWSMFFKJJAEVIV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |