C10H16N8O — CID 107067032
5-[2-(methylamino)ethylamino]-2-[(2-methyltetrazol-5-yl)methyl]pyridazin-3-one (PubChem CID 107067032) has the molecular formula C10H16N8O and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-[2-(methylamino)ethylamino]-2-[(2-methyltetrazol-5-yl)methyl]pyridazin-3-one.
| Compound Name | 5-[2-(methylamino)ethylamino]-2-[(2-methyltetrazol-5-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 107067032 |
| Molecular Formula | C10H16N8O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-[2-(methylamino)ethylamino]-2-[(2-methyltetrazol-5-yl)methyl]pyridazin-3-one |
| SMILES | CNCCNc1cnn(Cc2nnn(C)n2)c(=O)c1 |
| InChI | InChI=1S/C10H16N8O/c1-11-3-4-12-8-5-10(19)18(13-6-8)7-9-14-16-17(2)15-9/h5-6,11-12H,3-4,7H2,1-2H3 |
| InChIKey | IPJFYZYDNVPMSF-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|