C14H18N4O2 — CID 107067060
methyl 2-(aminomethyl)-3-(1-methyltriazol-4-yl)-2-phenylpropanoate (PubChem CID 107067060) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-3-(1-methyltriazol-4-yl)-2-phenylpropanoate.
| Compound Name | methyl 2-(aminomethyl)-3-(1-methyltriazol-4-yl)-2-phenylpropanoate |
|---|---|
| PubChem CID | 107067060 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 2-(aminomethyl)-3-(1-methyltriazol-4-yl)-2-phenylpropanoate |
| SMILES | COC(=O)C(CN)(Cc1cn(C)nn1)c1ccccc1 |
| InChI | InChI=1S/C14H18N4O2/c1-18-9-12(16-17-18)8-14(10-15,13(19)20-2)11-6-4-3-5-7-11/h3-7,9H,8,10,15H2,1-2H3 |
| InChIKey | FTOKQYQIHMQSEF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |