C17H21N3O — CID 107067502
3-methyl-N-(8-methylquinolin-5-yl)piperidine-2-carboxamide (PubChem CID 107067502) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-methyl-N-(8-methylquinolin-5-yl)piperidine-2-carboxamide.
| Compound Name | 3-methyl-N-(8-methylquinolin-5-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 107067502 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-methyl-N-(8-methylquinolin-5-yl)piperidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2NCCCC2C)c2cccnc12 |
| InChI | InChI=1S/C17H21N3O/c1-11-5-3-9-19-16(11)17(21)20-14-8-7-12(2)15-13(14)6-4-10-18-15/h4,6-8,10-11,16,19H,3,5,9H2,1-2H3,(H,20,21) |
| InChIKey | WIWZFECCIYRHLH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |