About 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile
3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile (PubChem CID 10706927) has the molecular formula C14H9N3OS
and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile |
| PubChem CID | 10706927 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc2ccsc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C14H9N3OS/c15-8-12-16-11-6-7-19-13(11)14(18)17(12)9-10-4-2-1-3-5-10/h1-7H,9H2 |
| InChIKey | VIFXCDYMGWFGKG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile?
The IUPAC name of 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile (CID 10706927) is 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile.
What is the SMILES notation for 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile?
The canonical SMILES for 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile is N#Cc1nc2ccsc2c(=O)n1Cc1ccccc1.
What is the InChIKey of 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile?
The InChIKey is VIFXCDYMGWFGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3OS/c15-8-12-16-11-6-7-19-13(11)14(18)17(12)9-10-4-2-1-3-5-10/h1-7H,9H2.
What are the key properties of 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile?
3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile has a molecular weight of 267.31 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-oxothieno[3,2-d]pyrimidine-2-carbonitrile is sourced from PubChem (CID 10706927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).