C15H21ClN2O3 — CID 107069435
1-(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-3-methylpiperidine-2-carboxylic acid (PubChem CID 107069435) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-3-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-3-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107069435 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-3-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCCN(C(=O)c2cc(Cl)cn2C(C)C)C1C(=O)O |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(2)18-8-11(16)7-12(18)14(19)17-6-4-5-10(3)13(17)15(20)21/h7-10,13H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | TUJDZQNJMODEHB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |