About 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate
2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate (PubChem CID 10707024) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate |
| PubChem CID | 10707024 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1=C(C)C[C@@H](OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C15H24O4/c1-10-8-13(19-12(3)17)9-15(4,5)14(10)6-7-18-11(2)16/h13H,6-9H2,1-5H3/t13-/m1/s1 |
| InChIKey | NQRVUNUPDWMEIQ-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate?
The IUPAC name of 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate (CID 10707024) is 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate.
What is the SMILES notation for 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate?
The canonical SMILES for 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate is CC(=O)OCCC1=C(C)C[C@@H](OC(C)=O)CC1(C)C.
What is the InChIKey of 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate?
The InChIKey is NQRVUNUPDWMEIQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H24O4/c1-10-8-13(19-12(3)17)9-15(4,5)14(10)6-7-18-11(2)16/h13H,6-9H2,1-5H3/t13-/m1/s1.
What are the key properties of 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate?
2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate has a molecular weight of 268.35 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]ethyl acetate is sourced from PubChem (CID 10707024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).