About 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide
2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide (PubChem CID 107070601) has the molecular formula C9H17N3O3S
and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide |
| PubChem CID | 107070601 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)N(C)C)C1N=C=O |
| InChI | InChI=1S/C9H17N3O3S/c1-8-5-4-6-12(9(8)10-7-13)16(14,15)11(2)3/h8-9H,4-6H2,1-3H3 |
| InChIKey | FUIHWBKZNYZZRE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide?
The IUPAC name of 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide (CID 107070601) is 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide.
What is the SMILES notation for 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide?
The canonical SMILES for 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide is CC1CCCN(S(=O)(=O)N(C)C)C1N=C=O.
What is the InChIKey of 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide?
The InChIKey is FUIHWBKZNYZZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3S/c1-8-5-4-6-12(9(8)10-7-13)16(14,15)11(2)3/h8-9H,4-6H2,1-3H3.
What are the key properties of 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide?
2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide has a molecular weight of 247.32 g/mol, XLogP of 0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-N,N,3-trimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 107070601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).