C14H26O3Si — CID 10707199
prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoate (PubChem CID 10707199) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoate.
| Compound Name | prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoate |
|---|---|
| PubChem CID | 10707199 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@H](O)/C=C/C)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-7-9-12(15)13(11(3)18(4,5)6)14(16)17-10-8-2/h7-9,11-13,15H,2,10H2,1,3-6H3/b9-7+/t11-,12-,13+/m1/s1 |
| InChIKey | HLIIYAZPYOOUOS-RHQFPOTISA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|