C14H25NO2 — CID 107072525
1-hept-6-enyl-3-methylpiperidine-2-carboxylic acid (PubChem CID 107072525) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-hept-6-enyl-3-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-hept-6-enyl-3-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107072525 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-hept-6-enyl-3-methylpiperidine-2-carboxylic acid |
| SMILES | C=CCCCCCN1CCCC(C)C1C(=O)O |
| InChI | InChI=1S/C14H25NO2/c1-3-4-5-6-7-10-15-11-8-9-12(2)13(15)14(16)17/h3,12-13H,1,4-11H2,2H3,(H,16,17) |
| InChIKey | YZWWWMQQEUMGRR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|