About 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine
5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 107072621) has the molecular formula C8H15N5
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 107072621 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CC1CCCNC1c1nc(N)n[nH]1 |
| InChI | InChI=1S/C8H15N5/c1-5-3-2-4-10-6(5)7-11-8(9)13-12-7/h5-6,10H,2-4H2,1H3,(H3,9,11,12,13) |
| InChIKey | TYNBTIMLCDVNOL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine (CID 107072621) is 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine is CC1CCCNC1c1nc(N)n[nH]1.
What is the InChIKey of 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine?
The InChIKey is TYNBTIMLCDVNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5/c1-5-3-2-4-10-6(5)7-11-8(9)13-12-7/h5-6,10H,2-4H2,1H3,(H3,9,11,12,13).
What are the key properties of 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine?
5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine has a molecular weight of 181.24 g/mol, XLogP of 0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylpiperidin-2-yl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 107072621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).