C13H18N2O3S — CID 107073384
butyl 2-(3-carbamothioyl-6-methyl-2-oxo-1-pyridinyl)acetate (PubChem CID 107073384) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is butyl 2-(3-carbamothioyl-6-methyl-2-oxo-1-pyridinyl)acetate.
| Compound Name | butyl 2-(3-carbamothioyl-6-methyl-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 107073384 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | butyl 2-(3-carbamothioyl-6-methyl-2-oxo-1-pyridinyl)acetate |
| SMILES | CCCCOC(=O)Cn1c(C)ccc(C(N)=S)c1=O |
| InChI | InChI=1S/C13H18N2O3S/c1-3-4-7-18-11(16)8-15-9(2)5-6-10(12(14)19)13(15)17/h5-6H,3-4,7-8H2,1-2H3,(H2,14,19) |
| InChIKey | GWWLQJQRJRDEFL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|