About 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide
1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide (PubChem CID 107073517) has the molecular formula C9H11F2N3O2
and a molecular weight of 231.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide |
| PubChem CID | 107073517 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(N)=N/O)c(=O)n1CC(F)F |
| InChI | InChI=1S/C9H11F2N3O2/c1-5-2-3-6(8(12)13-16)9(15)14(5)4-7(10)11/h2-3,7,16H,4H2,1H3,(H2,12,13) |
| InChIKey | TZBFOADGJSKRQS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide?
The IUPAC name of 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide (CID 107073517) is 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide.
What is the SMILES notation for 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide?
The canonical SMILES for 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide is Cc1ccc(/C(N)=N/O)c(=O)n1CC(F)F.
What is the InChIKey of 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide?
The InChIKey is TZBFOADGJSKRQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O2/c1-5-2-3-6(8(12)13-16)9(15)14(5)4-7(10)11/h2-3,7,16H,4H2,1H3,(H2,12,13).
What are the key properties of 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide?
1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide has a molecular weight of 231.20 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide is sourced from PubChem (CID 107073517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).