C11H14F3N3O3 — CID 107073567
N'-hydroxy-6-methyl-2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboximidamide (PubChem CID 107073567) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is N'-hydroxy-6-methyl-2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-methyl-2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107073567 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N'-hydroxy-6-methyl-2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(N)=N/O)c(=O)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3/c1-7-2-3-8(9(15)16-19)10(18)17(7)4-5-20-6-11(12,13)14/h2-3,19H,4-6H2,1H3,(H2,15,16) |
| InChIKey | NLWAKVITUWWKKX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|