C15H20N2O4 — CID 107074308
ethyl 1-(4-amino-3-hydroxybenzoyl)piperidine-3-carboxylate (PubChem CID 107074308) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is ethyl 1-(4-amino-3-hydroxybenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-amino-3-hydroxybenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 107074308 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 1-(4-amino-3-hydroxybenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(N)c(O)c2)C1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-21-15(20)11-4-3-7-17(9-11)14(19)10-5-6-12(16)13(18)8-10/h5-6,8,11,18H,2-4,7,9,16H2,1H3 |
| InChIKey | DFEHNZXXLRJYIZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|