About dibenzo-p-dioxin-2-amine
dibenzo-p-dioxin-2-amine (PubChem CID 1070744) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is dibenzo-p-dioxin-2-amine.
Molecular Properties
| Compound Name | dibenzo-p-dioxin-2-amine |
| PubChem CID | 1070744 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | dibenzo-p-dioxin-2-amine |
| SMILES | Nc1ccc2c(c1)Oc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,13H2 |
| InChIKey | HEQHKDYXHRCKHZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzo-p-dioxin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzo-p-dioxin-2-amine?
The IUPAC name of dibenzo-p-dioxin-2-amine (CID 1070744) is dibenzo-p-dioxin-2-amine.
What is the SMILES notation for dibenzo-p-dioxin-2-amine?
The canonical SMILES for dibenzo-p-dioxin-2-amine is Nc1ccc2c(c1)Oc1ccccc1O2.
What is the InChIKey of dibenzo-p-dioxin-2-amine?
The InChIKey is HEQHKDYXHRCKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,13H2.
What are the key properties of dibenzo-p-dioxin-2-amine?
dibenzo-p-dioxin-2-amine has a molecular weight of 199.21 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzo-p-dioxin-2-amine is sourced from PubChem (CID 1070744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).