C13H9NO6 — CID 10707521
2,3,4-trihydroxy-5-(3-nitrophenyl)cyclohepta-2,4,6-trien-1-one (PubChem CID 10707521) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2,3,4-trihydroxy-5-(3-nitrophenyl)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3,4-trihydroxy-5-(3-nitrophenyl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 10707521 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2,3,4-trihydroxy-5-(3-nitrophenyl)cyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1ccc(-c2cccc([N+](=O)[O-])c2)c(O)c(O)c1O |
| InChI | InChI=1S/C13H9NO6/c15-10-5-4-9(11(16)13(18)12(10)17)7-2-1-3-8(6-7)14(19)20/h1-6H,(H3,15,16,17,18) |
| InChIKey | SGVUAGNGBQKVNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|