C15H16O5 — CID 10707583
[(5aS,6R)-3,5a-dimethyl-1-oxo-6,7,8,9-tetrahydropyrano[4,3-b]chromen-6-yl] formate (PubChem CID 10707583) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(5aS,6R)-3,5a-dimethyl-1-oxo-6,7,8,9-tetrahydropyrano[4,3-b]chromen-6-yl] formate.
| Compound Name | [(5aS,6R)-3,5a-dimethyl-1-oxo-6,7,8,9-tetrahydropyrano[4,3-b]chromen-6-yl] formate |
|---|---|
| PubChem CID | 10707583 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(5aS,6R)-3,5a-dimethyl-1-oxo-6,7,8,9-tetrahydropyrano[4,3-b]chromen-6-yl] formate |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CCC[C@@H](OC=O)[C@@]1(C)O2 |
| InChI | InChI=1S/C15H16O5/c1-9-6-12-11(14(17)19-9)7-10-4-3-5-13(18-8-16)15(10,2)20-12/h6-8,13H,3-5H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | ZLQXUTGLPIGZDO-HIFRSBDPSA-N |
| XLogP | 2.21 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|