C12H18N2O3 — CID 107076037
2-amino-N-(2-ethoxypropyl)-5-hydroxybenzamide (PubChem CID 107076037) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-amino-N-(2-ethoxypropyl)-5-hydroxybenzamide.
| Compound Name | 2-amino-N-(2-ethoxypropyl)-5-hydroxybenzamide |
|---|---|
| PubChem CID | 107076037 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-amino-N-(2-ethoxypropyl)-5-hydroxybenzamide |
| SMILES | CCOC(C)CNC(=O)c1cc(O)ccc1N |
| InChI | InChI=1S/C12H18N2O3/c1-3-17-8(2)7-14-12(16)10-6-9(15)4-5-11(10)13/h4-6,8,15H,3,7,13H2,1-2H3,(H,14,16) |
| InChIKey | DSQKQSKOTCKAHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|