C16H29N5 — CID 107076253
N-ethyl-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-3-yl]ethanamine (PubChem CID 107076253) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-ethyl-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-3-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 107076253 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-ethyl-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-3-yl]ethanamine |
| SMILES | CCNC(C)C1CCCN(Cc2nnc3n2CCCC3)C1 |
| InChI | InChI=1S/C16H29N5/c1-3-17-13(2)14-7-6-9-20(11-14)12-16-19-18-15-8-4-5-10-21(15)16/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | MDHQNWSQRFPEFF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |