C13H14Cl2N4 — CID 107076942
2,5-dichloro-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline (PubChem CID 107076942) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2,5-dichloro-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline.
| Compound Name | 2,5-dichloro-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107076942 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2,5-dichloro-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline |
| SMILES | Clc1ccc(Cl)c(NCc2nnc3n2CCCC3)c1 |
| InChI | InChI=1S/C13H14Cl2N4/c14-9-4-5-10(15)11(7-9)16-8-13-18-17-12-3-1-2-6-19(12)13/h4-5,7,16H,1-3,6,8H2 |
| InChIKey | FDSLLRADCXEZEO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |