C14H16F2N4S — CID 107076989
2-(difluoromethylsulfanyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline (PubChem CID 107076989) has the molecular formula C14H16F2N4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107076989 |
| Molecular Formula | C14H16F2N4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)aniline |
| SMILES | FC(F)Sc1ccccc1NCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C14H16F2N4S/c15-14(16)21-11-6-2-1-5-10(11)17-9-13-19-18-12-7-3-4-8-20(12)13/h1-2,5-6,14,17H,3-4,7-9H2 |
| InChIKey | ZAJLBHMZWBIQEG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |