C13H17F3O3 — CID 10707707
[(1S,6S,8aR)-6-hydroxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 10707707) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is [(1S,6S,8aR)-6-hydroxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1S,6S,8aR)-6-hydroxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 10707707 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [(1S,6S,8aR)-6-hydroxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCCC2=C[C@@H](O)CC[C@@]21C(F)(F)F |
| InChI | InChI=1S/C13H17F3O3/c1-8(17)19-11-4-2-3-9-7-10(18)5-6-12(9,11)13(14,15)16/h7,10-11,18H,2-6H2,1H3/t10-,11-,12+/m0/s1 |
| InChIKey | MNNOMWOIBFVAQW-SDDRHHMPSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|