C14H17N3O3 — CID 107077483
3-amino-2-[(1-propan-2-ylpyrazol-3-yl)methoxy]benzoic acid (PubChem CID 107077483) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-amino-2-[(1-propan-2-ylpyrazol-3-yl)methoxy]benzoic acid.
| Compound Name | 3-amino-2-[(1-propan-2-ylpyrazol-3-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107077483 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-amino-2-[(1-propan-2-ylpyrazol-3-yl)methoxy]benzoic acid |
| SMILES | CC(C)n1ccc(COc2c(N)cccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H17N3O3/c1-9(2)17-7-6-10(16-17)8-20-13-11(14(18)19)4-3-5-12(13)15/h3-7,9H,8,15H2,1-2H3,(H,18,19) |
| InChIKey | PSQVHPNGOLLEMV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|