C12H15N3O4 — CID 107077632
3-amino-2-[2-(2-oxoimidazolidin-1-yl)ethoxy]benzoic acid (PubChem CID 107077632) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-amino-2-[2-(2-oxoimidazolidin-1-yl)ethoxy]benzoic acid.
| Compound Name | 3-amino-2-[2-(2-oxoimidazolidin-1-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 107077632 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-amino-2-[2-(2-oxoimidazolidin-1-yl)ethoxy]benzoic acid |
| SMILES | Nc1cccc(C(=O)O)c1OCCN1CCNC1=O |
| InChI | InChI=1S/C12H15N3O4/c13-9-3-1-2-8(11(16)17)10(9)19-7-6-15-5-4-14-12(15)18/h1-3H,4-7,13H2,(H,14,18)(H,16,17) |
| InChIKey | KBTABYGJKORBDW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|