C13H15FN4S — CID 107077998
3-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline (PubChem CID 107077998) has the molecular formula C13H15FN4S and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline.
| Compound Name | 3-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 107077998 |
| Molecular Formula | C13H15FN4S |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCc2nnc3n2CCCC3)c(F)c1 |
| InChI | InChI=1S/C13H15FN4S/c14-10-7-9(15)4-5-11(10)19-8-13-17-16-12-3-1-2-6-18(12)13/h4-5,7H,1-3,6,8,15H2 |
| InChIKey | YZOHSQKYJVKUEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|