C13H21N7S — CID 107078006
[4-propan-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 107078006) has the molecular formula C13H21N7S and a molecular weight of 307.43 g/mol. Its IUPAC name is [4-propan-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-propan-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 107078006 |
| Molecular Formula | C13H21N7S |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [4-propan-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | CC(C)n1c(CN)nnc1SCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C13H21N7S/c1-9(2)20-11(7-14)16-18-13(20)21-8-12-17-15-10-5-3-4-6-19(10)12/h9H,3-8,14H2,1-2H3 |
| InChIKey | GXPJXSUHWPMJFI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |