C13H15F3N4O — CID 107078485
2,2,2-trifluoro-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrol-3-yl]ethanol (PubChem CID 107078485) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrol-3-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrol-3-yl]ethanol |
|---|---|
| PubChem CID | 107078485 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrol-3-yl]ethanol |
| SMILES | OC(c1ccn(Cc2nnc3n2CCCC3)c1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4O/c14-13(15,16)12(21)9-4-6-19(7-9)8-11-18-17-10-3-1-2-5-20(10)11/h4,6-7,12,21H,1-3,5,8H2 |
| InChIKey | WHDZODVHTSANGQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |