About 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine
4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine (PubChem CID 107080299) has the molecular formula C12H20BrN3O
and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine |
| PubChem CID | 107080299 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine |
| SMILES | Cc1nn(C)c(N2CC(C)OCC2C)c1CBr |
| InChI | InChI=1S/C12H20BrN3O/c1-8-7-17-9(2)6-16(8)12-11(5-13)10(3)14-15(12)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | SFHNNMCTJTZQPM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine?
The IUPAC name of 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine (CID 107080299) is 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine.
What is the SMILES notation for 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine?
The canonical SMILES for 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine is Cc1nn(C)c(N2CC(C)OCC2C)c1CBr.
What is the InChIKey of 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine?
The InChIKey is SFHNNMCTJTZQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20BrN3O/c1-8-7-17-9(2)6-16(8)12-11(5-13)10(3)14-15(12)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine?
4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine has a molecular weight of 302.22 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-2,5-dimethylmorpholine is sourced from PubChem (CID 107080299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).