C14H23BrN2 — CID 107080869
5-(bromomethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine (PubChem CID 107080869) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 5-(bromomethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine.
| Compound Name | 5-(bromomethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107080869 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-(bromomethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine |
| SMILES | CC(C)CN(CC(C)C)c1ccc(CBr)cn1 |
| InChI | InChI=1S/C14H23BrN2/c1-11(2)9-17(10-12(3)4)14-6-5-13(7-15)8-16-14/h5-6,8,11-12H,7,9-10H2,1-4H3 |
| InChIKey | PHSXFBCWRLQKGZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|