C17H20BrNO — CID 107081032
4-(bromomethyl)-N-[(4-methoxyphenyl)methyl]-N,3-dimethylaniline (PubChem CID 107081032) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(4-methoxyphenyl)methyl]-N,3-dimethylaniline.
| Compound Name | 4-(bromomethyl)-N-[(4-methoxyphenyl)methyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 107081032 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-(bromomethyl)-N-[(4-methoxyphenyl)methyl]-N,3-dimethylaniline |
| SMILES | COc1ccc(CN(C)c2ccc(CBr)c(C)c2)cc1 |
| InChI | InChI=1S/C17H20BrNO/c1-13-10-16(7-6-15(13)11-18)19(2)12-14-4-8-17(20-3)9-5-14/h4-10H,11-12H2,1-3H3 |
| InChIKey | XECLHDPNNYMZIX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|