C14H19Br2N — CID 107081123
1-[5-bromo-2-(bromomethyl)phenyl]-4-ethylpiperidine (PubChem CID 107081123) has the molecular formula C14H19Br2N and a molecular weight of 361.12 g/mol. Its IUPAC name is 1-[5-bromo-2-(bromomethyl)phenyl]-4-ethylpiperidine.
| Compound Name | 1-[5-bromo-2-(bromomethyl)phenyl]-4-ethylpiperidine |
|---|---|
| PubChem CID | 107081123 |
| Molecular Formula | C14H19Br2N |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 1-[5-bromo-2-(bromomethyl)phenyl]-4-ethylpiperidine |
| SMILES | CCC1CCN(c2cc(Br)ccc2CBr)CC1 |
| InChI | InChI=1S/C14H19Br2N/c1-2-11-5-7-17(8-6-11)14-9-13(16)4-3-12(14)10-15/h3-4,9,11H,2,5-8,10H2,1H3 |
| InChIKey | KTPGCIAYXSJLDV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|