About 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine
5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine (PubChem CID 107081147) has the molecular formula C13H21BrN2
and a molecular weight of 285.23 g/mol. Its IUPAC name is 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine |
| PubChem CID | 107081147 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine |
| SMILES | Cc1cc(CBr)cnc1N(C)CCC(C)C |
| InChI | InChI=1S/C13H21BrN2/c1-10(2)5-6-16(4)13-11(3)7-12(8-14)9-15-13/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | DRNALVFOUWTWQC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine?
The IUPAC name of 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine (CID 107081147) is 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine.
What is the SMILES notation for 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine?
The canonical SMILES for 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine is Cc1cc(CBr)cnc1N(C)CCC(C)C.
What is the InChIKey of 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine?
The InChIKey is DRNALVFOUWTWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrN2/c1-10(2)5-6-16(4)13-11(3)7-12(8-14)9-15-13/h7,9-10H,5-6,8H2,1-4H3.
What are the key properties of 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine?
5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine has a molecular weight of 285.23 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-N,3-dimethyl-N-(3-methylbutyl)pyridin-2-amine is sourced from PubChem (CID 107081147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).