About 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile
4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile (PubChem CID 10708119) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile |
| PubChem CID | 10708119 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile |
| SMILES | CCC(CC)Nc1c(Nc2ccc(C#N)cc2)c(=O)c1=O |
| InChI | InChI=1S/C16H17N3O2/c1-3-11(4-2)18-13-14(16(21)15(13)20)19-12-7-5-10(9-17)6-8-12/h5-8,11,18-19H,3-4H2,1-2H3 |
| InChIKey | ATRRFTIXIOUHKJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile?
The IUPAC name of 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile (CID 10708119) is 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile?
The canonical SMILES for 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile is CCC(CC)Nc1c(Nc2ccc(C#N)cc2)c(=O)c1=O.
What is the InChIKey of 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile?
The InChIKey is ATRRFTIXIOUHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-3-11(4-2)18-13-14(16(21)15(13)20)19-12-7-5-10(9-17)6-8-12/h5-8,11,18-19H,3-4H2,1-2H3.
What are the key properties of 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile?
4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile has a molecular weight of 283.33 g/mol, XLogP of 2.50, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]benzonitrile is sourced from PubChem (CID 10708119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).