C15H17BrN2S — CID 107081264
5-(bromomethyl)-N-cyclopropyl-3-methyl-N-(thiophen-3-ylmethyl)pyridin-2-amine (PubChem CID 107081264) has the molecular formula C15H17BrN2S and a molecular weight of 337.29 g/mol. Its IUPAC name is 5-(bromomethyl)-N-cyclopropyl-3-methyl-N-(thiophen-3-ylmethyl)pyridin-2-amine.
| Compound Name | 5-(bromomethyl)-N-cyclopropyl-3-methyl-N-(thiophen-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107081264 |
| Molecular Formula | C15H17BrN2S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 5-(bromomethyl)-N-cyclopropyl-3-methyl-N-(thiophen-3-ylmethyl)pyridin-2-amine |
| SMILES | Cc1cc(CBr)cnc1N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H17BrN2S/c1-11-6-13(7-16)8-17-15(11)18(14-2-3-14)9-12-4-5-19-10-12/h4-6,8,10,14H,2-3,7,9H2,1H3 |
| InChIKey | PMSPVQZBHVTBBW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|