C18H23BrN2 — CID 107081479
3-(bromomethyl)-N-methyl-N-(3-methylcyclohexyl)quinolin-2-amine (PubChem CID 107081479) has the molecular formula C18H23BrN2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 3-(bromomethyl)-N-methyl-N-(3-methylcyclohexyl)quinolin-2-amine.
| Compound Name | 3-(bromomethyl)-N-methyl-N-(3-methylcyclohexyl)quinolin-2-amine |
|---|---|
| PubChem CID | 107081479 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(bromomethyl)-N-methyl-N-(3-methylcyclohexyl)quinolin-2-amine |
| SMILES | CC1CCCC(N(C)c2nc3ccccc3cc2CBr)C1 |
| InChI | InChI=1S/C18H23BrN2/c1-13-6-5-8-16(10-13)21(2)18-15(12-19)11-14-7-3-4-9-17(14)20-18/h3-4,7,9,11,13,16H,5-6,8,10,12H2,1-2H3 |
| InChIKey | ACKVTHYIBASUTK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|