C13H14BrF2N — CID 107081637
2-[4-(bromomethyl)-2,6-difluorophenyl]-2-azabicyclo[2.2.1]heptane (PubChem CID 107081637) has the molecular formula C13H14BrF2N and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2,6-difluorophenyl]-2-azabicyclo[2.2.1]heptane.
| Compound Name | 2-[4-(bromomethyl)-2,6-difluorophenyl]-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 107081637 |
| Molecular Formula | C13H14BrF2N |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-[4-(bromomethyl)-2,6-difluorophenyl]-2-azabicyclo[2.2.1]heptane |
| SMILES | Fc1cc(CBr)cc(F)c1N1CC2CCC1C2 |
| InChI | InChI=1S/C13H14BrF2N/c14-6-9-4-11(15)13(12(16)5-9)17-7-8-1-2-10(17)3-8/h4-5,8,10H,1-3,6-7H2 |
| InChIKey | ZUUDONUAQWISJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|