About 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate
2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate (PubChem CID 10708211) has the molecular formula C15H24O3S
and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate.
Molecular Properties
| Compound Name | 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate |
| PubChem CID | 10708211 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate |
| SMILES | CCC(=O)OCCSC(=O)CC1=C(C)C(C)(C)CC1 |
| InChI | InChI=1S/C15H24O3S/c1-5-13(16)18-8-9-19-14(17)10-12-6-7-15(3,4)11(12)2/h5-10H2,1-4H3 |
| InChIKey | VEZVYFCRWDNTIW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate?
The IUPAC name of 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate (CID 10708211) is 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate.
What is the SMILES notation for 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate?
The canonical SMILES for 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate is CCC(=O)OCCSC(=O)CC1=C(C)C(C)(C)CC1.
What is the InChIKey of 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate?
The InChIKey is VEZVYFCRWDNTIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3S/c1-5-13(16)18-8-9-19-14(17)10-12-6-7-15(3,4)11(12)2/h5-10H2,1-4H3.
What are the key properties of 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate?
2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate has a molecular weight of 284.42 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylethyl propanoate is sourced from PubChem (CID 10708211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).