C15H22BrClN2 — CID 107082125
N-[2-(bromomethyl)-4-chlorophenyl]-1-ethyl-N-methylpiperidin-4-amine (PubChem CID 107082125) has the molecular formula C15H22BrClN2 and a molecular weight of 345.71 g/mol. Its IUPAC name is N-[2-(bromomethyl)-4-chlorophenyl]-1-ethyl-N-methylpiperidin-4-amine.
| Compound Name | N-[2-(bromomethyl)-4-chlorophenyl]-1-ethyl-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 107082125 |
| Molecular Formula | C15H22BrClN2 |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[2-(bromomethyl)-4-chlorophenyl]-1-ethyl-N-methylpiperidin-4-amine |
| SMILES | CCN1CCC(N(C)c2ccc(Cl)cc2CBr)CC1 |
| InChI | InChI=1S/C15H22BrClN2/c1-3-19-8-6-14(7-9-19)18(2)15-5-4-13(17)10-12(15)11-16/h4-5,10,14H,3,6-9,11H2,1-2H3 |
| InChIKey | NEOLXLNSKMOGGJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|