C14H22BrN — CID 107082142
4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylaniline (PubChem CID 107082142) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylaniline.
| Compound Name | 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylaniline |
|---|---|
| PubChem CID | 107082142 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylaniline |
| SMILES | CC(N(C)c1ccc(CBr)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H22BrN/c1-11(14(2,3)4)16(5)13-8-6-12(10-15)7-9-13/h6-9,11H,10H2,1-5H3 |
| InChIKey | ZREVQUBCCAPACE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|