C10H11BrF3N3 — CID 107082231
5-(bromomethyl)-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 107082231) has the molecular formula C10H11BrF3N3 and a molecular weight of 310.12 g/mol. Its IUPAC name is 5-(bromomethyl)-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | 5-(bromomethyl)-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107082231 |
| Molecular Formula | C10H11BrF3N3 |
| Molecular Weight | 310.12 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 5-(bromomethyl)-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)CN(c1ncc(CBr)cn1)C1CC1 |
| InChI | InChI=1S/C10H11BrF3N3/c11-3-7-4-15-9(16-5-7)17(8-1-2-8)6-10(12,13)14/h4-5,8H,1-3,6H2 |
| InChIKey | DRWNFOQXYZIUSR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|